saniyapresha saniyapresha

10-03-2022
Mathematics

contestada

If the ratio of boys to girls is 3 : 11 and there are 66 girls in the play, how many students are boys?

Respuesta :

mathstudent55 mathstudent55

10-03-2022

Answer:

18 boys

Step-by-step explanation:

boys/girls = 3/11 = b/66

3/11 = b/66

11b = 3 × 66

b = 3 × 6

b = 18

There are 18 boys.

Answer Link

Otras preguntas

Change subject of a formula Q13. Make p the subject of the formula y = 3p²-4

Jim takes out a mortgage for 30 years at an interest rate of 2.49% and his monthly repayments are $986.50. What is the principal loan amount? Round your answer

Deficiency of vitamin b can lead to

If an organism is in the genus Canis, what family is it in ? A B C D

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

10. Simplify:(4x2 - 2x) - (-5x2 - 8x).Fre.e Brainliest for the correct answer

the inner most layer of the earth

Describe the following pattern in your own word and write down three next terms:1;3;5;7;9

ANSWER ASAP!!! QUESTION 20!!!!!!

Which example best shows how speeches can be interactive? O A. Rae speaks louder when she realizes the audience in the back can't hear her. B. Deven goes to the