jsmithfl252p0qxcl jsmithfl252p0qxcl
  • 10-12-2017
  • Mathematics
contestada

Angles ∝ and β are the two acute angles in a right triangle. Use the relationship between sine and cosine to find the value of ∝ if ∝ < β. ?

sin(2x - 8) = cos(6x - 6)

Respuesta :

Rod44 Rod44
  • 10-12-2017
sin(2x-8)=cos(90-2x+8)=cos(6x-6).
So 98-2x=6x-6, 104=8x, x=13.
2x-8=18, 6x-6=72. The smaller angle is 18 and the larger angle is 72.
Answer Link
martinezfernan10109
martinezfernan10109 martinezfernan10109
  • 11-03-2021

Answer: 13

Step-by-step explanation:

I took the test

Answer Link

Otras preguntas

A security camera rotates 30° every 10 seconds. How long does it take the camera to rotate 360°?
find the perimeter and diagonal of a square whose area is equal to the area of a rectangle whose length is 9m and breadth is 4m
Which of these parts of an animal would be most likely to form a fossil? A Heart B Kidney C Eye D Tooth
Sam draws two polygons that are similar. The first polygon has a perimeter of 16 cm and the second polygon has a perimeter of 10 cm. If the shortest side of
Solve the system by substitution method X=-4y+4 3x-7y=-7
what is v/8=2 solution
an electric heater of power 1000W has a resistance of 10 ohm. calculate the magnitude of current
Is catalyst a reactant? Why or why not?
explain the idea known as "nationalism" and how it played a role in the weakining of the austrian and russian empires
c+ax=dxthis one has all variables and no numbers