kennleesmith99 kennleesmith99

13-02-2018
Social Studies

contestada

Which of the following is an example of using nonverbal communication to accent or emphasize verbal communication

Respuesta :

300996300996 300996300996

13-02-2018

to accent because you are not using words

Answer Link

Otras preguntas

find the area rectangle with side lengths 5/3 feet and 3/4 foot.

Verify that the given value is a solution for the trigonometric equation by showing that it makes the equation true: 1. 2 cos^2 x-cos x=0; 2π/3 2. 2 cos^2 x-c

Explain Which country was the first to abolish the divine right of kings

Tobin performed an experiment in which he mixed varying amounts of enzyme with an excess amount of substrate. He measured the rate of each reaction and recorded

What are Japanese goals in world war

what are the axis of symmetry and vertex of the quadratic function y=-2x^2-8x+5

Which graph best represents an equation with the values shown in the table? Please help!

simplify the expression using sum or difference identities cos(12)cos(-3)-sin(12)sin(-3)

Write the fraction for the part that shaded.Then find an equivalent fraction.

Solve the equation for x 2/3x-1/9x + 5 = 20